C18H18BrN3O3 — CID 126382219
(Z)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126382219) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is (Z)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126382219 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (Z)-3-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nn2c(C)ccc2C)cc(Br)c1O |
| InChI | InChI=1S/C18H18BrN3O3/c1-4-25-16-9-13(8-15(19)17(16)23)7-14(10-20)18(24)21-22-11(2)5-6-12(22)3/h5-9,23H,4H2,1-3H3,(H,21,24)/b14-7- |
| InChIKey | JMJXABZJMWRPNE-AUWJEWJLSA-N |
| XLogP | 3.65 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|