C25H19BrClN3O5 — CID 98079576
(Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 98079576) has the molecular formula C25H19BrClN3O5 and a molecular weight of 556.80 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98079576 |
| Molecular Formula | C25H19BrClN3O5 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H19BrClN3O5/c1-2-34-23-12-16(11-21(26)24(23)35-15-17-6-3-4-9-22(17)27)10-18(14-28)25(31)29-19-7-5-8-20(13-19)30(32)33/h3-13H,2,15H2,1H3,(H,29,31)/b18-10- |
| InChIKey | JZZHKINQVDSLSD-ZDLGFXPLSA-N |
| XLogP | 6.53 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|