C29H21Cl2N3O5 — CID 75409137
(Z)-3-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide (PubChem CID 75409137) has the molecular formula C29H21Cl2N3O5 and a molecular weight of 562.41 g/mol. Its IUPAC name is (Z)-3-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 75409137 |
| Molecular Formula | C29H21Cl2N3O5 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | (Z)-3-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2-chloro-4-nitrophenyl)-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H21Cl2N3O5/c1-2-38-27-14-18(12-21(16-32)29(35)33-26-11-10-22(34(36)37)15-24(26)30)13-25(31)28(27)39-17-20-8-5-7-19-6-3-4-9-23(19)20/h3-15H,2,17H2,1H3,(H,33,35)/b21-12- |
| InChIKey | SWKTTXYTEIULFX-MTJSOVHGSA-N |
| XLogP | 7.58 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|