C25H18Cl2IN3O5 — CID 124602627
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 124602627) has the molecular formula C25H18Cl2IN3O5 and a molecular weight of 638.25 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124602627 |
| Molecular Formula | C25H18Cl2IN3O5 |
| Molecular Weight | 638.25 g/mol |
| Exact Mass | 636.97 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-ethoxy-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)cc(I)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H18Cl2IN3O5/c1-2-35-22-12-16(9-17(13-29)25(32)30-21-8-4-7-19(26)23(21)27)11-20(28)24(22)36-14-15-5-3-6-18(10-15)31(33)34/h3-12H,2,14H2,1H3,(H,30,32)/b17-9- |
| InChIKey | KTHZGKKKBFHKHY-MFOYZWKCSA-N |
| XLogP | 7.03 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.25 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|