C23H13Cl2I2N3O4 — CID 99690378
(Z)-N-(2-chloro-4-nitrophenyl)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enamide (PubChem CID 99690378) has the molecular formula C23H13Cl2I2N3O4 and a molecular weight of 720.09 g/mol. Its IUPAC name is (Z)-N-(2-chloro-4-nitrophenyl)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(2-chloro-4-nitrophenyl)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 99690378 |
| Molecular Formula | C23H13Cl2I2N3O4 |
| Molecular Weight | 720.09 g/mol |
| Exact Mass | 718.84 |
| IUPAC Name | (Z)-N-(2-chloro-4-nitrophenyl)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccc(Cl)cc2)c(I)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H13Cl2I2N3O4/c24-16-3-1-13(2-4-16)12-34-22-19(26)8-14(9-20(22)27)7-15(11-28)23(31)29-21-6-5-17(30(32)33)10-18(21)25/h1-10H,12H2,(H,29,31)/b15-7- |
| InChIKey | FYGJEVHAMUNMDP-CHHVJCJISA-N |
| XLogP | 7.24 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.09 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|