C24H14Cl2I2N2O4 — CID 126006558
4-[[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126006558) has the molecular formula C24H14Cl2I2N2O4 and a molecular weight of 719.10 g/mol. Its IUPAC name is 4-[[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126006558 |
| Molecular Formula | C24H14Cl2I2N2O4 |
| Molecular Weight | 719.10 g/mol |
| Exact Mass | 717.84 |
| IUPAC Name | 4-[[4-[(Z)-2-cyano-3-(2,4-dichloroanilino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccc(C(=O)O)cc2)c(I)c1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H14Cl2I2N2O4/c25-17-5-6-21(18(26)10-17)30-23(31)16(11-29)7-14-8-19(27)22(20(28)9-14)34-12-13-1-3-15(4-2-13)24(32)33/h1-10H,12H2,(H,30,31)(H,32,33)/b16-7- |
| InChIKey | LXORPKUDTXFILH-APSNUPSMSA-N |
| XLogP | 7.03 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.10 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|