C24H22I2N2O4 — CID 126342386
4-[[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid (PubChem CID 126342386) has the molecular formula C24H22I2N2O4 and a molecular weight of 656.26 g/mol. Its IUPAC name is 4-[[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126342386 |
| Molecular Formula | C24H22I2N2O4 |
| Molecular Weight | 656.26 g/mol |
| Exact Mass | 655.97 |
| IUPAC Name | 4-[[4-[(Z)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]-2,6-diiodophenoxy]methyl]benzoic acid |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccc(C(=O)O)cc2)c(I)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H22I2N2O4/c25-20-11-16(10-18(13-27)23(29)28-19-4-2-1-3-5-19)12-21(26)22(20)32-14-15-6-8-17(9-7-15)24(30)31/h6-12,19H,1-5,14H2,(H,28,29)(H,30,31)/b18-10- |
| InChIKey | MYTNBQLMCMRBIY-ZDLGFXPLSA-N |
| XLogP | 5.53 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.26 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|