C22H18Br2Cl2N2O2 — CID 126198645
(Z)-2-cyano-N-cyclopentyl-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126198645) has the molecular formula C22H18Br2Cl2N2O2 and a molecular weight of 573.11 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126198645 |
| Molecular Formula | C22H18Br2Cl2N2O2 |
| Molecular Weight | 573.11 g/mol |
| Exact Mass | 569.91 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H18Br2Cl2N2O2/c23-17-8-14(7-15(11-27)22(29)28-16-3-1-2-4-16)9-18(24)21(17)30-12-13-5-6-19(25)20(26)10-13/h5-10,16H,1-4,12H2,(H,28,29)/b15-7- |
| InChIKey | XCPSTCBSLJJSCM-CHHVJCJISA-N |
| XLogP | 7.06 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.11 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|