C23H19Cl2N3O2 — CID 126197947
(Z)-2-cyano-N-cyclopentyl-3-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126197947) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126197947 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCc2ccccc2C#N)c(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H19Cl2N3O2/c24-20-10-15(9-18(13-27)23(29)28-19-7-3-4-8-19)11-21(25)22(20)30-14-17-6-2-1-5-16(17)12-26/h1-2,5-6,9-11,19H,3-4,7-8,14H2,(H,28,29)/b18-9- |
| InChIKey | LJWVGDMZBRPJDO-NVMNQCDNSA-N |
| XLogP | 5.41 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|