C23H21Cl3N2O3 — CID 126200403
(Z)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126200403) has the molecular formula C23H21Cl3N2O3 and a molecular weight of 479.79 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126200403 |
| Molecular Formula | C23H21Cl3N2O3 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (Z)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC2CCCC2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl3N2O3/c1-30-21-10-14(8-16(12-27)23(29)28-18-4-2-3-5-18)9-20(26)22(21)31-13-15-6-7-17(24)11-19(15)25/h6-11,18H,2-5,13H2,1H3,(H,28,29)/b16-8- |
| InChIKey | NVQXXMTYGXGTSI-PXNMLYILSA-N |
| XLogP | 6.20 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|