C23H21BrCl2N2O3 — CID 126196071
(Z)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126196071) has the molecular formula C23H21BrCl2N2O3 and a molecular weight of 524.24 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126196071 |
| Molecular Formula | C23H21BrCl2N2O3 |
| Molecular Weight | 524.24 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC2CCCC2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21BrCl2N2O3/c1-30-21-10-14(8-16(12-27)23(29)28-18-4-2-3-5-18)9-19(24)22(21)31-13-15-6-7-17(25)11-20(15)26/h6-11,18H,2-5,13H2,1H3,(H,28,29)/b16-8- |
| InChIKey | UBTPYVJEOXTESM-PXNMLYILSA-N |
| XLogP | 6.31 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.24 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|