C24H24BrFN2O3 — CID 126202919
(Z)-3-[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126202919) has the molecular formula C24H24BrFN2O3 and a molecular weight of 487.37 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126202919 |
| Molecular Formula | C24H24BrFN2O3 |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (Z)-3-[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC2CCCC2)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H24BrFN2O3/c1-2-30-22-13-16(11-18(14-27)24(29)28-19-8-4-5-9-19)12-20(25)23(22)31-15-17-7-3-6-10-21(17)26/h3,6-7,10-13,19H,2,4-5,8-9,15H2,1H3,(H,28,29)/b18-11- |
| InChIKey | YIGOCPJAEIOJRT-WQRHYEAKSA-N |
| XLogP | 5.53 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|