C29H22BrFN2O3 — CID 18531068
(Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 18531068) has the molecular formula C29H22BrFN2O3 and a molecular weight of 545.41 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18531068 |
| Molecular Formula | C29H22BrFN2O3 |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | (Z)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccccc2F)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H22BrFN2O3/c1-2-35-27-16-19(14-22(17-32)29(34)33-26-13-6-5-12-25(26)31)15-24(30)28(27)36-18-21-10-7-9-20-8-3-4-11-23(20)21/h3-16H,2,18H2,1H3,(H,33,34)/b22-14- |
| InChIKey | JPWDNNFUIXDJNW-HMAPJEAMSA-N |
| XLogP | 7.26 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|