C28H21BrFNO2 — CID 126398869
(E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398869) has the molecular formula C28H21BrFNO2 and a molecular weight of 502.38 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398869 |
| Molecular Formula | C28H21BrFNO2 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2cccc(F)c2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H21BrFNO2/c1-2-32-27-15-19(13-23(17-31)21-9-6-11-24(30)16-21)14-26(29)28(27)33-18-22-10-5-8-20-7-3-4-12-25(20)22/h3-16H,2,18H2,1H3/b23-13- |
| InChIKey | YVYRNXSEYZYFFF-QRVIBDJDSA-N |
| XLogP | 7.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|