C28H21I2NO2 — CID 126377301
(E)-3-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-2-(4-iodophenyl)prop-2-enenitrile (PubChem CID 126377301) has the molecular formula C28H21I2NO2 and a molecular weight of 657.29 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-2-(4-iodophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-2-(4-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126377301 |
| Molecular Formula | C28H21I2NO2 |
| Molecular Weight | 657.29 g/mol |
| Exact Mass | 656.97 |
| IUPAC Name | (E)-3-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-2-(4-iodophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(I)cc2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H21I2NO2/c1-2-32-27-16-19(14-23(17-31)20-10-12-24(29)13-11-20)15-26(30)28(27)33-18-22-8-5-7-21-6-3-4-9-25(21)22/h3-16H,2,18H2,1H3/b23-14- |
| InChIKey | PERRNGKJJBWBPA-UCQKPKSFSA-N |
| XLogP | 8.09 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.29 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|