C32H29NO2 — CID 21375275
(E)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375275) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375275 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(/C#N)c2ccc(C)cc2)cc(OCC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H29NO2/c1-4-9-27-18-24(19-29(21-33)25-16-14-23(3)15-17-25)20-31(34-5-2)32(27)35-22-28-12-8-11-26-10-6-7-13-30(26)28/h4,6-8,10-20H,1,5,9,22H2,2-3H3/b29-19- |
| InChIKey | UIVUSQVWWNCLKG-CEUNXORHSA-N |
| XLogP | 7.92 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|