C28H26FNO2 — CID 126396184
(E)-3-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126396184) has the molecular formula C28H26FNO2 and a molecular weight of 427.52 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126396184 |
| Molecular Formula | C28H26FNO2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (E)-3-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(/C#N)c2cccc(F)c2)cc(OCC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H26FNO2/c1-4-7-24-14-22(15-25(18-30)23-8-6-9-26(29)17-23)16-27(31-5-2)28(24)32-19-21-12-10-20(3)11-13-21/h4,6,8-17H,1,5,7,19H2,2-3H3/b25-15- |
| InChIKey | JAUNBAIJTCSOIV-MYYYXRDXSA-N |
| XLogP | 6.90 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|