C24H19ClFNO2 — CID 126398697
(E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398697) has the molecular formula C24H19ClFNO2 and a molecular weight of 407.87 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398697 |
| Molecular Formula | C24H19ClFNO2 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H19ClFNO2/c1-16-6-8-17(9-7-16)15-29-24-22(25)11-18(12-23(24)28-2)10-20(14-27)19-4-3-5-21(26)13-19/h3-13H,15H2,1-2H3/b20-10- |
| InChIKey | WOPFEOFQJBHYDW-JMIUGGIZSA-N |
| XLogP | 6.44 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|