C25H21Cl2NO2 — CID 21375174
(E)-3-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375174) has the molecular formula C25H21Cl2NO2 and a molecular weight of 438.35 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375174 |
| Molecular Formula | C25H21Cl2NO2 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (E)-3-[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(C)cc2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21Cl2NO2/c1-3-29-24-14-19(12-21(15-28)20-8-4-17(2)5-9-20)13-23(27)25(24)30-16-18-6-10-22(26)11-7-18/h4-14H,3,16H2,1-2H3/b21-12- |
| InChIKey | ZKOVCBASGOMMJY-MTJSOVHGSA-N |
| XLogP | 7.34 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|