C24H17Cl2NO4 — CID 2202748
4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 2202748) has the molecular formula C24H17Cl2NO4 and a molecular weight of 454.31 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 2202748 |
| Molecular Formula | C24H17Cl2NO4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 4-[[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(Cl)cc2)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H17Cl2NO4/c1-30-22-12-16(10-19(13-27)17-6-8-20(25)9-7-17)11-21(26)23(22)31-14-15-2-4-18(5-3-15)24(28)29/h2-12H,14H2,1H3,(H,28,29)/b19-10- |
| InChIKey | XDSPRMBJDINNDD-GRSHGNNSSA-N |
| XLogP | 6.34 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|