C25H22ClNO2 — CID 21375026
(E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375026) has the molecular formula C25H22ClNO2 and a molecular weight of 403.91 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375026 |
| Molecular Formula | C25H22ClNO2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(C)cc2)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H22ClNO2/c1-17-4-8-19(9-5-17)16-29-25-23(26)13-20(14-24(25)28-3)12-22(15-27)21-10-6-18(2)7-11-21/h4-14H,16H2,1-3H3/b22-12- |
| InChIKey | FPHYXRUVNAELCI-UUYOSTAYSA-N |
| XLogP | 6.61 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|