C24H17Cl2NO3 — CID 21374957
4-[[2,6-dichloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]methyl]benzoic acid (PubChem CID 21374957) has the molecular formula C24H17Cl2NO3 and a molecular weight of 438.31 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 21374957 |
| Molecular Formula | C24H17Cl2NO3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(/C(C#N)=C\c2cc(Cl)c(OCc3ccc(C(=O)O)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H17Cl2NO3/c1-15-2-6-18(7-3-15)20(13-27)10-17-11-21(25)23(22(26)12-17)30-14-16-4-8-19(9-5-16)24(28)29/h2-12H,14H2,1H3,(H,28,29)/b20-10- |
| InChIKey | BMHVPNSAGCVZCG-JMIUGGIZSA-N |
| XLogP | 6.64 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|