C23H14Cl2FNO3 — CID 126397910
4-[[2,6-dichloro-4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]phenoxy]methyl]benzoic acid (PubChem CID 126397910) has the molecular formula C23H14Cl2FNO3 and a molecular weight of 442.27 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126397910 |
| Molecular Formula | C23H14Cl2FNO3 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 4-[[2,6-dichloro-4-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]phenoxy]methyl]benzoic acid |
| SMILES | N#C/C(=C/c1cc(Cl)c(OCc2ccc(C(=O)O)cc2)c(Cl)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H14Cl2FNO3/c24-20-9-15(8-18(12-27)17-2-1-3-19(26)11-17)10-21(25)22(20)30-13-14-4-6-16(7-5-14)23(28)29/h1-11H,13H2,(H,28,29)/b18-8- |
| InChIKey | QPEYMXAGHLNBQM-LSCVHKIXSA-N |
| XLogP | 6.47 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|