C24H15Cl2N3O3 — CID 126072730
4-[[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenoxy]methyl]benzoic acid (PubChem CID 126072730) has the molecular formula C24H15Cl2N3O3 and a molecular weight of 464.31 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126072730 |
| Molecular Formula | C24H15Cl2N3O3 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-[[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenoxy]methyl]benzoic acid |
| SMILES | N#C/C(=C\c1cc(Cl)c(OCc2ccc(C(=O)O)cc2)c(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H15Cl2N3O3/c25-18-10-15(9-17(12-27)23-28-20-3-1-2-4-21(20)29-23)11-19(26)22(18)32-13-14-5-7-16(8-6-14)24(30)31/h1-11H,13H2,(H,28,29)(H,30,31)/b17-9+ |
| InChIKey | AGHASZGJSPBIJK-RQZCQDPDSA-N |
| XLogP | 6.21 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|