C25H19BrClN3O2 — CID 126379101
(E)-2-(1H-benzimidazol-2-yl)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile (PubChem CID 126379101) has the molecular formula C25H19BrClN3O2 and a molecular weight of 508.80 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126379101 |
| Molecular Formula | C25H19BrClN3O2 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)c2nc3ccccc3[nH]2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19BrClN3O2/c1-2-31-23-13-17(11-18(14-28)25-29-21-5-3-4-6-22(21)30-25)12-20(26)24(23)32-15-16-7-9-19(27)10-8-16/h3-13H,2,15H2,1H3,(H,29,30)/b18-11+ |
| InChIKey | RKDGXVQNDOHSKE-WOJGMQOQSA-N |
| XLogP | 7.02 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|