C25H17BrN4O2 — CID 2947260
4-[[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 2947260) has the molecular formula C25H17BrN4O2 and a molecular weight of 485.34 g/mol. Its IUPAC name is 4-[[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 2947260 |
| Molecular Formula | C25H17BrN4O2 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 4-[[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(C=C(C#N)c2nc3ccccc3[nH]2)cc(Br)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H17BrN4O2/c1-31-23-12-18(10-19(14-28)25-29-21-4-2-3-5-22(21)30-25)11-20(26)24(23)32-15-17-8-6-16(13-27)7-9-17/h2-12H,15H2,1H3,(H,29,30) |
| InChIKey | SHTULFILUYXISW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|