C24H18N4O4 — CID 110530972
(Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 110530972) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110530972 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)cc([N+](=O)[O-])c1OCc1ccccc1 |
| InChI | InChI=1S/C24H18N4O4/c1-31-22-13-17(11-18(14-25)24-26-19-9-5-6-10-20(19)27-24)12-21(28(29)30)23(22)32-15-16-7-3-2-4-8-16/h2-13H,15H2,1H3,(H,26,27)/b18-11- |
| InChIKey | WSTVVLBWVVNSLC-WQRHYEAKSA-N |
| XLogP | 5.12 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|