C25H19ClN4O5 — CID 6240570
(E)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 6240570) has the molecular formula C25H19ClN4O5 and a molecular weight of 490.90 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6240570 |
| Molecular Formula | C25H19ClN4O5 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-(6-methoxy-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(/C(C#N)=C/c3cc(Cl)c(OCc4cccc([N+](=O)[O-])c4)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C25H19ClN4O5/c1-33-19-6-7-21-22(12-19)29-25(28-21)17(13-27)8-16-10-20(26)24(23(11-16)34-2)35-14-15-4-3-5-18(9-15)30(31)32/h3-12H,14H2,1-2H3,(H,28,29)/b17-8+ |
| InChIKey | UQTXJWAZPGIAJQ-CAOOACKPSA-N |
| XLogP | 5.78 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|