C26H20ClN3O4 — CID 124548781
3-[[2-chloro-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 124548781) has the molecular formula C26H20ClN3O4 and a molecular weight of 473.92 g/mol. Its IUPAC name is 3-[[2-chloro-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-chloro-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 124548781 |
| Molecular Formula | C26H20ClN3O4 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 3-[[2-chloro-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H20ClN3O4/c1-15-6-7-21-22(8-15)30-25(29-21)19(13-28)10-17-11-20(27)24(23(12-17)33-2)34-14-16-4-3-5-18(9-16)26(31)32/h3-12H,14H2,1-2H3,(H,29,30)(H,31,32)/b19-10- |
| InChIKey | ZYPPKNQJGUWGLB-GRSHGNNSSA-N |
| XLogP | 5.87 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|