C25H18Cl2IN3O2 — CID 126379275
(Z)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126379275) has the molecular formula C25H18Cl2IN3O2 and a molecular weight of 590.25 g/mol. Its IUPAC name is (Z)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126379275 |
| Molecular Formula | C25H18Cl2IN3O2 |
| Molecular Weight | 590.25 g/mol |
| Exact Mass | 588.98 |
| IUPAC Name | (Z)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H18Cl2IN3O2/c1-14-3-6-21-22(7-14)31-25(30-21)17(12-29)8-16-10-20(28)24(23(11-16)32-2)33-13-15-4-5-18(26)19(27)9-15/h3-11H,13H2,1-2H3,(H,30,31)/b17-8- |
| InChIKey | WOFCONHTZZAEQK-IUXPMGMMSA-N |
| XLogP | 7.43 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.25 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|