C24H16BrI2N3O — CID 126378590
(Z)-3-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126378590) has the molecular formula C24H16BrI2N3O and a molecular weight of 696.12 g/mol. Its IUPAC name is (Z)-3-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126378590 |
| Molecular Formula | C24H16BrI2N3O |
| Molecular Weight | 696.12 g/mol |
| Exact Mass | 694.86 |
| IUPAC Name | (Z)-3-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3cc(I)c(OCc4ccc(Br)cc4)c(I)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H16BrI2N3O/c1-14-2-7-21-22(8-14)30-24(29-21)17(12-28)9-16-10-19(26)23(20(27)11-16)31-13-15-3-5-18(25)6-4-15/h2-11H,13H2,1H3,(H,29,30)/b17-9- |
| InChIKey | JEHDYIOBHZMUND-MFOYZWKCSA-N |
| XLogP | 7.49 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.12 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|