C19H13I2N3O3 — CID 3986117
2-[4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 3986117) has the molecular formula C19H13I2N3O3 and a molecular weight of 585.14 g/mol. Its IUPAC name is 2-[4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 3986117 |
| Molecular Formula | C19H13I2N3O3 |
| Molecular Weight | 585.14 g/mol |
| Exact Mass | 584.90 |
| IUPAC Name | 2-[4-[2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cc(I)c(OCC(=O)O)c(I)c3)[nH]c2c1 |
| InChI | InChI=1S/C19H13I2N3O3/c1-10-2-3-15-16(4-10)24-19(23-15)12(8-22)5-11-6-13(20)18(14(21)7-11)27-9-17(25)26/h2-7H,9H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | DTFVFWUCWHDNLC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|