C26H19IN4O2 — CID 126378874
2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126378874) has the molecular formula C26H19IN4O2 and a molecular weight of 546.37 g/mol. Its IUPAC name is 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126378874 |
| Molecular Formula | C26H19IN4O2 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-iodo-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H19IN4O2/c1-16-7-8-22-23(9-16)31-26(30-22)20(14-29)10-17-11-21(27)25(24(12-17)32-2)33-15-19-6-4-3-5-18(19)13-28/h3-12H,15H2,1-2H3,(H,30,31)/b20-10- |
| InChIKey | LFXUYUYMDFCLKL-JMIUGGIZSA-N |
| XLogP | 6.00 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|