C27H21BrN4O2 — CID 126377820
2-[[5-bromo-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 126377820) has the molecular formula C27H21BrN4O2 and a molecular weight of 513.40 g/mol. Its IUPAC name is 2-[[5-bromo-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[5-bromo-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126377820 |
| Molecular Formula | C27H21BrN4O2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 2-[[5-bromo-4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H21BrN4O2/c1-3-33-25-12-20(11-21(15-30)27-31-23-9-8-17(2)10-24(23)32-27)22(28)13-26(25)34-16-19-7-5-4-6-18(19)14-29/h4-13H,3,16H2,1-2H3,(H,31,32)/b21-11- |
| InChIKey | FWSBUXXLVGWRFG-NHDPSOOVSA-N |
| XLogP | 6.55 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|