C26H20BrCl2N3O2 — CID 126377990
(Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126377990) has the molecular formula C26H20BrCl2N3O2 and a molecular weight of 557.28 g/mol. Its IUPAC name is (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126377990 |
| Molecular Formula | C26H20BrCl2N3O2 |
| Molecular Weight | 557.28 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccc(C)cc3[nH]2)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H20BrCl2N3O2/c1-3-33-24-10-17(9-18(13-30)26-31-22-7-4-15(2)8-23(22)32-26)20(27)12-25(24)34-14-16-5-6-19(28)11-21(16)29/h4-12H,3,14H2,1-2H3,(H,31,32)/b18-9- |
| InChIKey | IMBZLYLRQNACRN-NVMNQCDNSA-N |
| XLogP | 7.98 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.28 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|