C21H19BrCl2N2O3 — CID 1285854
(Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 1285854) has the molecular formula C21H19BrCl2N2O3 and a molecular weight of 498.20 g/mol. Its IUPAC name is (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 1285854 |
| Molecular Formula | C21H19BrCl2N2O3 |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | (Z)-3-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N(C)C)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19BrCl2N2O3/c1-4-28-19-8-14(7-15(11-25)21(27)26(2)3)17(22)10-20(19)29-12-13-5-6-16(23)9-18(13)24/h5-10H,4,12H2,1-3H3/b15-7- |
| InChIKey | LDSHBUXIRUDUCO-CHHVJCJISA-N |
| XLogP | 5.73 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|