C17H11BrCl2N2O2 — CID 17269852
(E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enamide (PubChem CID 17269852) has the molecular formula C17H11BrCl2N2O2 and a molecular weight of 426.10 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 17269852 |
| Molecular Formula | C17H11BrCl2N2O2 |
| Molecular Weight | 426.10 g/mol |
| Exact Mass | 423.94 |
| IUPAC Name | (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCc1ccc(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C17H11BrCl2N2O2/c18-13-2-4-16(11(6-13)5-12(8-21)17(22)23)24-9-10-1-3-14(19)7-15(10)20/h1-7H,9H2,(H2,22,23)/b12-5+ |
| InChIKey | ZROOMEFJOOHLGH-LFYBBSHMSA-N |
| XLogP | 4.73 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.10 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|