C16H10BrCl2NO — CID 6278260
(E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 6278260) has the molecular formula C16H10BrCl2NO and a molecular weight of 383.07 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6278260 |
| Molecular Formula | C16H10BrCl2NO |
| Molecular Weight | 383.07 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | (E)-3-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C=C/c1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10BrCl2NO/c17-13-4-6-16(11(8-13)2-1-7-20)21-10-12-3-5-14(18)9-15(12)19/h1-6,8-9H,10H2/b2-1+ |
| InChIKey | JSKGVEQVKSHNED-OWOJBTEDSA-N |
| XLogP | 5.87 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.07 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|