C21H15BrCl3NO — CID 126217471
1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(5-chloro-2-methylphenyl)methanimine (PubChem CID 126217471) has the molecular formula C21H15BrCl3NO and a molecular weight of 483.62 g/mol. Its IUPAC name is 1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(5-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(5-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126217471 |
| Molecular Formula | C21H15BrCl3NO |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 480.94 |
| IUPAC Name | 1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(5-chloro-2-methylphenyl)methanimine |
| SMILES | Cc1ccc(Cl)cc1/N=C/c1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15BrCl3NO/c1-13-2-5-18(24)10-20(13)26-11-15-8-16(22)4-7-21(15)27-12-14-3-6-17(23)9-19(14)25/h2-11H,12H2,1H3/b26-11+ |
| InChIKey | NEWAHEZPSHFRQG-KBKYJPHKSA-N |
| XLogP | 8.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|