C21H16BrCl2NO — CID 126219723
1-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine (PubChem CID 126219723) has the molecular formula C21H16BrCl2NO and a molecular weight of 449.18 g/mol. Its IUPAC name is 1-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126219723 |
| Molecular Formula | C21H16BrCl2NO |
| Molecular Weight | 449.18 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 1-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
| SMILES | Cc1c(Cl)cccc1/N=C/c1cc(Br)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H16BrCl2NO/c1-14-18(23)7-4-8-20(14)25-12-16-11-17(22)9-10-21(16)26-13-15-5-2-3-6-19(15)24/h2-12H,13H2,1H3/b25-12+ |
| InChIKey | PNLOFEVYXVWKGX-BRJLIKDPSA-N |
| XLogP | 7.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.18 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|