C25H19BrClNO — CID 126219557
1-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(3-chloro-2-methylphenyl)methanimine (PubChem CID 126219557) has the molecular formula C25H19BrClNO and a molecular weight of 464.79 g/mol. Its IUPAC name is 1-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(3-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126219557 |
| Molecular Formula | C25H19BrClNO |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 1-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
| SMILES | Cc1c(Cl)cccc1/N=C/c1ccc(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C25H19BrClNO/c1-17-23(27)10-5-11-24(17)28-15-18-12-13-25(22(26)14-18)29-16-20-8-4-7-19-6-2-3-9-21(19)20/h2-15H,16H2,1H3/b28-15+ |
| InChIKey | SSXNZPVMQRARBQ-RWPZCVJISA-N |
| XLogP | 7.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|