C22H19ClFNO — CID 126206108
1-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine (PubChem CID 126206108) has the molecular formula C22H19ClFNO and a molecular weight of 367.85 g/mol. Its IUPAC name is 1-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126206108 |
| Molecular Formula | C22H19ClFNO |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[3-chloro-4-[(2-fluorophenyl)methoxy]phenyl]-N-(2,3-dimethylphenyl)methanimine |
| SMILES | Cc1cccc(/N=C/c2ccc(OCc3ccccc3F)c(Cl)c2)c1C |
| InChI | InChI=1S/C22H19ClFNO/c1-15-6-5-9-21(16(15)2)25-13-17-10-11-22(19(23)12-17)26-14-18-7-3-4-8-20(18)24/h3-13H,14H2,1-2H3/b25-13+ |
| InChIKey | FJNZZORIFNSNOV-DHRITJCHSA-N |
| XLogP | 6.43 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|