C23H23NO2 — CID 126218926
N-(2,3-dimethylphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)methanimine (PubChem CID 126218926) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)methanimine.
| Compound Name | N-(2,3-dimethylphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126218926 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(C)c2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-17-8-7-11-21(18(17)2)24-15-20-12-13-22(23(14-20)25-3)26-16-19-9-5-4-6-10-19/h4-15H,16H2,1-3H3/b24-15+ |
| InChIKey | PXISHWVHXPNPEA-BUVRLJJBSA-N |
| XLogP | 5.64 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|