C24H24BrNO2 — CID 126214078
1-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine (PubChem CID 126214078) has the molecular formula C24H24BrNO2 and a molecular weight of 438.37 g/mol. Its IUPAC name is 1-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine.
| Compound Name | 1-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126214078 |
| Molecular Formula | C24H24BrNO2 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-N-(2,3-dimethylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2cccc(C)c2C)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H24BrNO2/c1-4-27-23-14-20(15-26-22-12-8-9-17(2)18(22)3)13-21(25)24(23)28-16-19-10-6-5-7-11-19/h5-15H,4,16H2,1-3H3/b26-15+ |
| InChIKey | BQUWMIWACLWYDT-CVKSISIWSA-N |
| XLogP | 6.79 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|