C23H20BrCl2NO2 — CID 126206843
1-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-chloro-4-methylphenyl)methanimine (PubChem CID 126206843) has the molecular formula C23H20BrCl2NO2 and a molecular weight of 493.23 g/mol. Its IUPAC name is 1-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-chloro-4-methylphenyl)methanimine.
| Compound Name | 1-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-chloro-4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126206843 |
| Molecular Formula | C23H20BrCl2NO2 |
| Molecular Weight | 493.23 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 1-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-N-(3-chloro-4-methylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(Cl)c2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H20BrCl2NO2/c1-3-28-22-11-17(13-27-19-8-7-15(2)21(26)12-19)10-20(24)23(22)29-14-16-5-4-6-18(25)9-16/h4-13H,3,14H2,1-2H3/b27-13+ |
| InChIKey | IYLIAYCQZBEFIQ-UVHMKAGCSA-N |
| XLogP | 7.79 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.23 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|