C21H15Br2Cl2NO — CID 126216784
N-(3-chloro-4-methylphenyl)-1-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methanimine (PubChem CID 126216784) has the molecular formula C21H15Br2Cl2NO and a molecular weight of 528.07 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126216784 |
| Molecular Formula | C21H15Br2Cl2NO |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 524.89 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methanimine |
| SMILES | Cc1ccc(/N=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)cc1Cl |
| InChI | InChI=1S/C21H15Br2Cl2NO/c1-13-2-7-17(10-20(13)25)26-11-15-8-18(22)21(19(23)9-15)27-12-14-3-5-16(24)6-4-14/h2-11H,12H2,1H3/b26-11+ |
| InChIKey | LNACDVPPZMYFDV-KBKYJPHKSA-N |
| XLogP | 8.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|