C19H17BrClNO2 — CID 126205504
1-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-N-(3-chloro-4-methylphenyl)methanimine (PubChem CID 126205504) has the molecular formula C19H17BrClNO2 and a molecular weight of 406.71 g/mol. Its IUPAC name is 1-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-N-(3-chloro-4-methylphenyl)methanimine.
| Compound Name | 1-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-N-(3-chloro-4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126205504 |
| Molecular Formula | C19H17BrClNO2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 1-(3-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-N-(3-chloro-4-methylphenyl)methanimine |
| SMILES | C#CCOc1c(Br)cc(/C=N/c2ccc(C)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C19H17BrClNO2/c1-4-8-24-19-16(20)9-14(10-18(19)23-5-2)12-22-15-7-6-13(3)17(21)11-15/h1,6-7,9-12H,5,8H2,2-3H3/b22-12+ |
| InChIKey | BYTLCUBPAXQUBZ-WSDLNYQXSA-N |
| XLogP | 5.57 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|