C17H18BrNO2 — CID 137059390
2-bromo-4-[(3,4-dimethylphenyl)iminomethyl]-6-ethoxyphenol (PubChem CID 137059390) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 2-bromo-4-[(3,4-dimethylphenyl)iminomethyl]-6-ethoxyphenol.
| Compound Name | 2-bromo-4-[(3,4-dimethylphenyl)iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 137059390 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-bromo-4-[(3,4-dimethylphenyl)iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(C)c2)cc(Br)c1O |
| InChI | InChI=1S/C17H18BrNO2/c1-4-21-16-9-13(8-15(18)17(16)20)10-19-14-6-5-11(2)12(3)7-14/h5-10,20H,4H2,1-3H3/b19-10+ |
| InChIKey | XNBXHIPCONKLOT-VXLYETTFSA-N |
| XLogP | 4.92 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|