C15H13Br2NO — CID 137138656
2,6-dibromo-4-[(3,4-dimethylphenyl)iminomethyl]phenol (PubChem CID 137138656) has the molecular formula C15H13Br2NO and a molecular weight of 383.08 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3,4-dimethylphenyl)iminomethyl]phenol.
| Compound Name | 2,6-dibromo-4-[(3,4-dimethylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137138656 |
| Molecular Formula | C15H13Br2NO |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 2,6-dibromo-4-[(3,4-dimethylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccc(/N=C/c2cc(Br)c(O)c(Br)c2)cc1C |
| InChI | InChI=1S/C15H13Br2NO/c1-9-3-4-12(5-10(9)2)18-8-11-6-13(16)15(19)14(17)7-11/h3-8,19H,1-2H3/b18-8+ |
| InChIKey | NZONJNXZENSCOU-QGMBQPNBSA-N |
| XLogP | 5.28 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|