C22H18Br2FNO — CID 126214636
1-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126214636) has the molecular formula C22H18Br2FNO and a molecular weight of 491.20 g/mol. Its IUPAC name is 1-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126214636 |
| Molecular Formula | C22H18Br2FNO |
| Molecular Weight | 491.20 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 1-[3,5-dibromo-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc(Br)c(OCc3ccccc3F)c(Br)c2)cc1C |
| InChI | InChI=1S/C22H18Br2FNO/c1-14-7-8-18(9-15(14)2)26-12-16-10-19(23)22(20(24)11-16)27-13-17-5-3-4-6-21(17)25/h3-12H,13H2,1-2H3/b26-12+ |
| InChIKey | BXQHRRZPCZYVKX-RPPGKUMJSA-N |
| XLogP | 7.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.20 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|